ChemNet > CAS > 132747-20-7 (1S,4S)-2,5-diazabicyclo[2.2.1]heptane dihydrobromide
132747-20-7 (1S,4S)-2,5-diazabicyclo[2.2.1]heptane dihydrobromide
نام محصول |
(1S,4S)-2,5-diazabicyclo[2.2.1]heptane dihydrobromide |
مترادف |
(1S,4S)-2,5-Diazabicyclo(2.2.1)heptane.2HBr; (1S,2S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide; (1S,4S)-(+)-2,5-diazabicyclo [2,2,1]heptane dihydrobromide; 2,5-diazabicyclo[2.2.1]heptane dihydrobromide |
میدان مغناطیسی |
C5H12Br2N2 |
وزن مولکولی |
259.9702 |
InChI |
InChI=1/C5H10N2.2BrH/c1-4-2-6-5(1)3-7-4;;/h4-7H,1-3H2;2*1H |
شماره سیایاس |
132747-20-7 |
ساختار مولکولی |
|
نقطه ذوب |
300 °C |
نقطه غلیان |
261.8°C at 760 mmHg |
نقطه اشتعال |
112.1°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|